BIOPEP-UWM: Report
| ID | 512 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Predicted ligand of the umami receptors (models based on sequences Q7RTX1 and Q7RTX0) | |||
| Number of residues | 11 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 1100.1818 | Monoisotopic mass | 1099.5394 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Feng H., Li W., Chang Y., Hong J., He Y., Wu F., He Z. | |
| Title | |
| A novel and efficient technique for peptides preparation coupled with enzyme membrane reactor from Lentinus edodes tails and identification of umami peptides by virtual screening. LWT, 230, 118255, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)NCC(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C48H73N15O15/c1-25(2)18-30(58-38(67)24-56-42(72)32(21-39(68)69)61-43(73)31(20-35(50)64)59-37(66)23-54-40(70)28(49)19-27-10-5-4-6-11-27)41(71)55-22-36(65)57-26(3)45(75)62-16-8-13-33(62)44(74)60-29(12-7-15-53-48(51)52)46(76)63-17-9-14-34(63)47(77)78/h4-6,10-11,25-26,28-34H,7-9,12-24,49H2,1-3H3,(H2,50,64)(H,54,70)(H,55,71)(H,56,72)(H,57,65)(H,58,67)(H,59,66)(H,60,74)(H,61,73)(H,68,69)(H,77,78)(H4,51,52,53)/t26-,28-,29-,30-,31-,32-,33-,34-/m0/s1 InChIKey=BBFTUWZSZGUVEX-KQBMMHAASA-N Activity predicted using molecular docking Models os structures of umami receptors have been obtained using SwissModel program (https://swissmodel.expasy.org/) using PDB ID: 7M3G as a template. |
| Database reference: |