BIOPEP-UWM: Report
| ID | 513 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Predicted ligand of the umami receptors (models based on sequences Q7RTX1 and Q7RTX0) | |||
| Number of residues | 10 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 1126.2190 | Monoisotopic mass | 1125.5550 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Feng H., Li W., Chang Y., Hong J., He Y., Wu F., He Z. | |
| Title | |
| A novel and efficient technique for peptides preparation coupled with enzyme membrane reactor from Lentinus edodes tails and identification of umami peptides by virtual screening. LWT, 230, 118255, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C50H75N15O15/c1-25(2)17-31(63-47(77)40(51)26(3)4)43(73)62-33(20-38(67)68)42(72)58-27(5)48(78)65-16-10-14-36(65)46(76)56-23-37(66)59-32(19-29-22-54-24-57-29)44(74)60-30(13-9-15-55-50(52)53)41(71)61-34(21-39(69)70)45(75)64-35(49(79)80)18-28-11-7-6-8-12-28/h6-8,11-12,22,24-27,30-36,40H,9-10,13-21,23,51H2,1-5H3,(H,54,57)(H,56,76)(H,58,72)(H,59,66)(H,60,74)(H,61,71)(H,62,73)(H,63,77)(H,64,75)(H,67,68)(H,69,70)(H,79,80)(H4,52,53,55)/t27-,30-,31-,32-,33-,34-,35-,36-,40-/m0/s1 InChIKey=XFPHDCSJDCYNOM-SFEYKEBWSA-N Activity predicted using molecular docking Models os structures of umami receptors have been obtained using SwissModel program (https://swissmodel.expasy.org/) using PDB ID: 7M3G as a template. |
| Database reference: |