BIOPEP-UWM: Report
| ID | 518 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Predicted ligand of the umami receptors (models based on sequences Q7RTX1 and Q7RTX0) | |||
| Number of residues | 5 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 514.5710 | Monoisotopic mass | 514.2742 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Feng H., Li W., Chang Y., Hong J., He Y., Wu F., He Z. | |
| Title | |
| A novel and efficient technique for peptides preparation coupled with enzyme membrane reactor from Lentinus edodes tails and identification of umami peptides by virtual screening. LWT, 230, 118255, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CCCCN)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C22H38N6O8/c1-12(2)18(21(34)28-9-5-7-15(28)22(35)36)27-20(33)14(10-17(30)31)26-16(29)11-25-19(32)13(24)6-3-4-8-23/h12-15,18H,3-11,23-24H2,1-2H3,(H,25,32)(H,26,29)(H,27,33)(H,30,31)(H,35,36)/t13-,14-,15-,18-/m0/s1 InChIKey=IGRKBSHZPUOUAA-XSWJXKHESA-N Activity predicted using molecular docking Models os structures of umami receptors have been obtained using SwissModel program (https://swissmodel.expasy.org/) using PDB ID: 7M3G as a template. |
| Database reference: |