BIOPEP-UWM: Report
| ID | 524 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Predicted ligand of Keap1 (PDB ID: 2FLU) | |||
| Number of residues | 7 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 741.9148 | Monoisotopic mass | 741.4411 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Z., Shu G., Nan J., Meng F., Zhang M., Chen L. | |
| Title | |
| Exploring the healthy potential of goat milk fermented by novel isolated lactic acid bacteria: Genetic identification, bioactive peptides, nutritional mechanism and sensory evaluation. Int. J. Food Microbiol., 442, 111354, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N1[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)C(C)C)CC(C)C)[C@H](CC)C)CCC2)Cc2ccccc2)CCC1 InChI=1S/C38H59N7O8/c1-7-24(6)32(36(50)40-26(19-22(2)3)33(47)42-31(23(4)5)38(52)53)43-35(49)29-16-12-18-45(29)37(51)27(20-25-13-9-8-10-14-25)41-34(48)28-15-11-17-44(28)30(46)21-39/h8-10,13-14,22-24,26-29,31-32H,7,11-12,15-21,39H2,1-6H3,(H,40,50)(H,41,48)(H,42,47)(H,43,49)(H,52,53)/t24-,26-,27-,28-,29-,31-,32-/m0/s1 InChIKey=DASCHEQGEKYNTI-YUQDWORRSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 9128); the DFBP database; the EROP-Moscow database; the MBPDB database |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9128 DFBP: ID DFBPACEI1451; DFBPDPIV0104; DFBPMUFU0388 EROP-Moscow: ID E14701 J-GLOBAL: ID 200907076066123363 MBPDB: Peptide GPFPILV Nikkaji: ID J2.243.265F Peptipedia: ID 9696 PubChem: CID 101776033 SureChEMBL: ID SCHEMBL30781626 |