BIOPEP-UWM: Report
| ID | 53 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Predicted ligand of SARS-CoV-2 parent protease (EC 3.4.22.69) (MEROPS ID: C30.007) (PDB ID: 6LU7) | |||
| Number of residues | 3 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 436.5040 | Monoisotopic mass | 436.2427 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Behzadipour Y., Gholampour M., Pirhadi S., Seradj H., Khoshneviszadeh M., Hemmati S. | |
| Title | |
| Viral 3CLpro as a target for antiviral intervention using milk‑derived bioactive peptides. Int. J. Pept. Res. Therapeut., 27, 2703–2716, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C20H32N6O5/c1-11(2)16(26-17(28)14(21)4-3-9-24-20(22)23)18(29)25-15(19(30)31)10-12-5-7-13(27)8-6-12/h5-8,11,14-16,27H,3-4,9-10,21H2,1-2H3,(H,25,29)(H,26,28)(H,30,31)(H4,22,23,24)/t14-,15-,16-/m0/s1 InChIKey=WHLDJYNHXOMGMU-JYJNAYRXSA-N Bioactivity predicted using molecular docking Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BIOPEP-UWM database of bioactive peptides (ID 9030); the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 1103, 1532, 4760, 5084, 5249, 6182 BioPepDB: ID biopep01229 BIOPEP-UWM database of bioactive peptides: ID 9030 BRENDA: Ligand Arg-Val-Tyr ChemSpider ID: 13164586 EPA DSSTox: ID DTXCID10531936 EROP-Moscow: ID E01341 PubChem: CID 16035988 SATPdb: ID satpdb24293 |