BIOPEP-UWM: Report
| ID | 531 |
| Name | Pancreatic elastase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of pancreatic elastase (EC 3.4.21.36) (PDB ID: 1BRU) | |||
| Number of residues | 6 |
Activity code | pel |
| Activity : | pancreatic elastase inhibitor |
|||
| Chemical mass | 631.5948 | Monoisotopic mass | 631.2666 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang R., Li Y., Li Y., Zhang H. | |
| Title | |
| Discovering potential anti‑skin‑aging peptides in collagen: computer‑assisted rapid screening and structure–activity relationships. Collagen and Leather, 7, 30, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(=O)N)C(=O)NCC(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C22H37N11O11/c23-9(4-17(38)39)18(40)29-7-16(37)32-12(6-14(25)35)20(42)33-11(5-13(24)34)19(41)30-8-15(36)31-10(21(43)44)2-1-3-28-22(26)27/h9-12H,1-8,23H2,(H2,24,34)(H2,25,35)(H,29,40)(H,30,41)(H,31,36)(H,32,37)(H,33,42)(H,38,39)(H,43,44)(H4,26,27,28)/t9-,10-,11-,12-/m0/s1 InChIKey=GYCFDNQTSOITAJ-BJDJZHNGSA-N Activity predicted using molecular docking |
| Database reference: |