BIOPEP-UWM: Report
| ID | 534 |
| Name | Pancreatic elastase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of pancreatic elastase (EC 3.4.21.36) (PDB ID: 1BRU) | |||
| Number of residues | 12 |
Activity code | pel |
| Activity : | pancreatic elastase inhibitor |
|||
| Chemical mass | 999.0336 | Monoisotopic mass | 998.4766 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang R., Li Y., Li Y., Zhang H. | |
| Title | |
| Discovering potential anti‑skin‑aging peptides in collagen: computer‑assisted rapid screening and structure–activity relationships. Collagen and Leather, 7, 30, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCCN)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C40H66N14O16/c1-19(50-35(64)21(3)48-29(57)16-46-37(66)23-9-7-13-43-23)33(62)45-17-31(59)53-26(14-27(42)55)39(68)51-20(2)34(63)44-15-28(56)49-22(4)36(65)54-24(8-5-6-12-41)38(67)47-18-30(58)52-25(40(69)70)10-11-32(60)61/h19-26,43H,5-18,41H2,1-4H3,(H2,42,55)(H,44,63)(H,45,62)(H,46,66)(H,47,67)(H,48,57)(H,49,56)(H,50,64)(H,51,68)(H,52,58)(H,53,59)(H,54,65)(H,60,61)(H,69,70)/t19-,20-,21-,22-,23-,24-,25-,26-/m0/s1 InChIKey=FOIFDVMUCTYJKQ-CAQMSIDYSA-N |
| Database reference: |