BIOPEP-UWM: Report
| ID | 543 |
| Name | Microbial collagenase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Microbial collagenase (EC 3.4.24.3) (MEROPS ID: M09.002) (PDB ID: 2Y6I) | |||
| Number of residues | 11 |
Activity code | mci |
| Activity : | microbial collagenase inhibitor |
|||
| Chemical mass | 926.9678 | Monoisotopic mass | 926.4443 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang R., Li Y., Li Y., Zhang H. | |
| Title | |
| Discovering potential anti‑skin‑aging peptides in collagen: computer‑assisted rapid screening and structure–activity relationships. Collagen and Leather, 7, 30, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)NCC(=O)N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C38H62N12O15/c1-20(45-27(53)16-41-26(52)15-40)33(59)42-18-29(55)48-32(21(2)51)37(63)50-14-6-8-24(50)35(61)44-19-30(56)49-13-5-9-25(49)36(62)47-22(7-3-4-12-39)34(60)43-17-28(54)46-23(38(64)65)10-11-31(57)58/h20-25,32,51H,3-19,39-40H2,1-2H3,(H,41,52)(H,42,59)(H,43,60)(H,44,61)(H,45,53)(H,46,54)(H,47,62)(H,48,55)(H,57,58)(H,64,65)/t20-,21+,22-,23-,24-,25-,32-/m0/s1 InChIKey=VEQPHFVCPYGWDV-RHAPBRBKSA-N Activity predicted using molecular docking Predicted inhibitor of pancreatic elastase (EC 3.4.21.36) (PDB ID: 1BRU) according to the BIOPEP-UWM Virtual database |
| Database reference: |