BIOPEP-UWM: Report
| ID | 545 |
| Name | Microbial collagenase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Microbial collagenase (EC 3.4.24.3) (MEROPS ID: M09.002) (PDB ID: 2Y6I) | |||
| Number of residues | 9 |
Activity code | mci |
| Activity : | microbial collagenase inhibitor |
|||
| Chemical mass | 919.9121 | Monoisotopic mass | 919.3329 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang R., Li Y., Li Y., Zhang H. | |
| Title | |
| Discovering potential anti‑skin‑aging peptides in collagen: computer‑assisted rapid screening and structure–activity relationships. Collagen and Leather, 7, 30, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C34H53N11O17S/c1-13(46)25(31(58)38-10-21(49)40-18(34(61)62)4-5-23(51)52)43-29(56)19(6-16-8-36-12-39-16)42-32(59)26(14(2)47)45-33(60)27(15(3)48)44-30(57)20(11-63)41-22(50)9-37-28(55)17(35)7-24(53)54/h8,12-15,17-20,25-27,46-48,63H,4-7,9-11,35H2,1-3H3,(H,36,39)(H,37,55)(H,38,58)(H,40,49)(H,41,50)(H,42,59)(H,43,56)(H,44,57)(H,45,60)(H,51,52)(H,53,54)(H,61,62)/t13-,14-,15-,17+,18+,19+,20+,25+,26+,27+/m1/s1 InChIKey=VEKUPGDYQLHHQM-WIQCTOSPSA-N Activity predicted using molecular docking Predicted inhibitor of pancreatic elastase (EC 3.4.21.36) (PDB ID: 1BRU) according to the BIOPEP-UWM Virtual database |
| Database reference: |