BIOPEP-UWM: Report
| ID | 549 |
| Name | Microbial collagenase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Microbial collagenase (EC 3.4.24.3) (MEROPS ID: M09.002) (PDB ID: 2Y6I) | |||
| Number of residues | 12 |
Activity code | mci |
| Activity : | microbial collagenase inhibitor |
|||
| Chemical mass | 999.0336 | Monoisotopic mass | 998.4766 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang R., Li Y., Li Y., Zhang H. | |
| Title | |
| Discovering potential anti‑skin‑aging peptides in collagen: computer‑assisted rapid screening and structure–activity relationships. Collagen and Leather, 7, 30, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C46H76N16O22/c1-21(38(76)52-18-30(65)57-25(9-12-34(70)71)41(79)61-27(45(83)84)7-5-15-51-46(49)50)55-40(78)24(8-11-33(68)69)56-32(67)20-54-44(82)37(22(2)63)62-42(80)26(10-13-35(72)73)58-31(66)19-53-39(77)23(6-3-4-14-47)60-43(81)28(16-36(74)75)59-29(64)17-48/h21-28,37,63H,3-20,47-48H2,1-2H3,(H,52,76)(H,53,77)(H,54,82)(H,55,78)(H,56,67)(H,57,65)(H,58,66)(H,59,64)(H,60,81)(H,61,79)(H,62,80)(H,68,69)(H,70,71)(H,72,73)(H,74,75)(H,83,84)(H4,49,50,51)/t21-,22+,23-,24-,25-,26-,27-,28-,37-/m0/s1 InChIKey=UMBLZMPYBWSXGY-TULCHRAISA-N Activity predicted using molecular docking Predicted inhibitor of pancreatic elastase (EC 3.4.21.36) (PDB ID: 1BRU) according to the BIOPEP-UWM Virtual database |
| Database reference: |