BIOPEP-UWM: Report
| ID | 55 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Predicted ligand of SARS-CoV-2 parent protease (EC 3.4.22.69) (MEROPS ID: C30.007) (PDB ID: 6LU7) | |||
| Number of residues | 3 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 419.4307 | Monoisotopic mass | 419.1799 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Behzadipour Y., Gholampour M., Pirhadi S., Seradj H., Khoshneviszadeh M., Hemmati S. | |
| Title | |
| Viral 3CLpro as a target for antiviral intervention using milk‑derived bioactive peptides. Int. J. Pept. Res. Therapeut., 27, 2703–2716, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C19H25N5O6/c20-12(5-6-16(21)26)17(27)24-15(9-25)18(28)23-14(19(29)30)7-10-8-22-13-4-2-1-3-11(10)13/h1-4,8,12,14-15,22,25H,5-7,9,20H2,(H2,21,26)(H,23,28)(H,24,27)(H,29,30)/t12-,14-,15-/m0/s1 InChIKey=QENSHQJGWGRPQS-QEJZJMRPSA-N Bioactivity predicted using molecular docking |
| Database reference: |
| ChEBI: ID 162488 ChemSpider: ID 61710871 J-GLOBAL: ID 200907062591753202 MMDB: ID 128381 Nikkaji: ID J2.110.552J PubChem: CID 91667417 |