BIOPEP-UWM: Report
| ID | 553 |
| Name | Microbial collagenase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Microbial collagenase (EC 3.4.24.3) (MEROPS ID: M09.002) (PDB ID: 2Y6I) | |||
| Number of residues | 6 |
Activity code | mci |
| Activity : | microbial collagenase inhibitor |
|||
| Chemical mass | 684.8104 | Monoisotopic mass | 684.3480 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang R., Li Y., Li Y., Zhang H. | |
| Title | |
| Discovering potential anti‑skin‑aging peptides in collagen: computer‑assisted rapid screening and structure–activity relationships. Collagen and Leather, 7, 30, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCCCN)C(=O)NCC(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C27H48N12O7S/c1-47-10-7-18(36-21(40)12-29)24(43)38-17(5-2-3-8-28)23(42)34-14-22(41)37-20(11-16-13-32-15-35-16)25(44)39-19(26(45)46)6-4-9-33-27(30)31/h13,15,17-20H,2-12,14,28-29H2,1H3,(H,32,35)(H,34,42)(H,36,40)(H,37,41)(H,38,43)(H,39,44)(H,45,46)(H4,30,31,33)/t17-,18-,19-,20-/m0/s1 InChIKey=BMNWITNYIOILCA-MUGJNUQGSA-N Activity predicted using molecular docking Predicted inhibitor of pancreatic elastase (EC 3.4.21.36) (PDB ID: 1BRU) according to the BIOPEP-UWM Virtual database |
| Database reference: |