BIOPEP-UWM: Report
| ID | 554 |
| Name | Microbial collagenase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Microbial collagenase (EC 3.4.24.3) (MEROPS ID: M09.002) (PDB ID: 2Y6I) | |||
| Number of residues | 12 |
Activity code | mci |
| Activity : | microbial collagenase inhibitor |
|||
| Chemical mass | 1115.1089 | Monoisotopic mass | 1114.4987 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang R., Li Y., Li Y., Zhang H. | |
| Title | |
| Discovering potential anti‑skin‑aging peptides in collagen: computer‑assisted rapid screening and structure–activity relationships. Collagen and Leather, 7, 30, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)NCC(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C43H70N16O19/c1-19(35(70)49-16-29(63)55-24(42(77)78)6-4-12-48-43(46)47)54-36(71)20(2)53-28(62)15-51-38(73)23(9-11-33(68)69)57-39(74)25(14-27(45)61)56-30(64)17-52-40(75)26-7-5-13-59(26)41(76)34(21(3)60)58-31(65)18-50-37(72)22(44)8-10-32(66)67/h19-26,34,60H,4-18,44H2,1-3H3,(H2,45,61)(H,49,70)(H,50,72)(H,51,73)(H,52,75)(H,53,62)(H,54,71)(H,55,63)(H,56,64)(H,57,74)(H,58,65)(H,66,67)(H,68,69)(H,77,78)(H4,46,47,48)/t19-,20-,21+,22-,23-,24-,25-,26-,34-/m0/s1 InChIKey=NUYHVOUTDIAORN-JLKGOKOISA-N Activity predicted using molecular docking Predicted inhibitor of pancreatic elastase (EC 3.4.21.36) (PDB ID: 1BRU) according to the BIOPEP-UWM Virtual database |
| Database reference: |