BIOPEP-UWM: Report
| ID | 560 |
| Name | Tyrosinase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Tyrosinase (EC 1.14.18.1) (PDB ID: 2Y9X) | |||
| Number of residues | 8 |
Activity code | tyr |
| Activity : | tyrosinase inhibitor |
|||
| Chemical mass | 837.8749 | Monoisotopic mass | 837.3968 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang R., Li Y., Li Y., Zhang H. | |
| Title | |
| Discovering potential anti‑skin‑aging peptides in collagen: computer‑assisted rapid screening and structure–activity relationships. Collagen and Leather, 7, 30, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C35H55N11O13/c1-17(2)11-22(31(55)45-24(13-28(52)53)30(54)40-15-26(50)42-21(34(58)59)5-4-10-39-35(37)38)44-27(51)16-41-33(57)29(18(3)47)46-32(56)23(43-25(49)14-36)12-19-6-8-20(48)9-7-19/h6-9,17-18,21-24,29,47-48H,4-5,10-16,36H2,1-3H3,(H,40,54)(H,41,57)(H,42,50)(H,43,49)(H,44,51)(H,45,55)(H,46,56)(H,52,53)(H,58,59)(H4,37,38,39)/t18-,21+,22+,23+,24+,29+/m1/s1 InChIKey=UCBSULWZCYSIQC-XHOOGHNISA-N Activity predicted using molecular docking Predicted inhibitor of pancreatic elastase (EC 3.4.21.36) (PDB ID: 1BRU) according to the BIOPEP-UWM Virtual database Predicted inhibitor of Microbial collagenase (EC 3.4.24.3) (MEROPS ID: M09.002) (PDB ID: 2Y6I) according to the BIOPEP-UWM Virtual database |
| Database reference: |