BIOPEP-UWM: Report
| ID | 570 |
| Name | Tyrosinase inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Tyrosinase (EC 1.14.18.1) (PDB ID: 2Y9X) | |||
| Number of residues | 5 |
Activity code | tyr |
| Activity : | tyrosinase inhibitor |
|||
| Chemical mass | 504.4903 | Monoisotopic mass | 504.2172 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang R., Li Y., Li Y., Zhang H. | |
| Title | |
| Discovering potential anti‑skin‑aging peptides in collagen: computer‑assisted rapid screening and structure–activity relationships. Collagen and Leather, 7, 30, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C19H32N6O10/c20-6-2-1-3-10(25-18(33)12(7-16(30)31)24-13(26)8-21)17(32)22-9-14(27)23-11(19(34)35)4-5-15(28)29/h10-12H,1-9,20-21H2,(H,22,32)(H,23,27)(H,24,26)(H,25,33)(H,28,29)(H,30,31)(H,34,35)/t10-,11-,12-/m0/s1 InChIKey=KVLCNRNHMMIQEB-SRVKXCTJSA-N Activity predicted using molecular docking Predicted inhibitor of pancreatic elastase (EC 3.4.21.36) (PDB ID: 1BRU) according to the BIOPEP-UWM Virtual database Predicted inhibitor of Microbial collagenase (EC 3.4.24.3) (MEROPS ID: M09.002) (PDB ID: 2Y6I) according to the BIOPEP-UWM Virtual database |
| Database reference: |