BIOPEP-UWM: Report
| ID | 611 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 247.2477 | Monoisotopic mass | 247.1164 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gu J., Yue S., Yang X., Lu Z., Wang Z., Wei X., Zhou L., Zhao Z., Shi Z., Zhao Z. | |
| Title | |
| Unlocking novel angiotensin-converting enzyme inhibitory peptides from Nili Ravi buffalo milk β-casein: A synergistic strategy combining targeted hydrolysis, 3D-QSAR modeling, and mechanistic insights. Food Biosci., 71, 107346, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C9H17N3O5/c1-4(13)7(9(16)17)12-8(15)5(10)2-3-6(11)14/h4-5,7,13H,2-3,10H2,1H3,(H2,11,14)(H,12,15)(H,16,17)/t4-,5+,7+/m1/s1 InChIKey=HHSJMSCOLJVTCX-ZDLURKLDSA-N Activity predicted using QSAR Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8878) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 8878 BRENDA: Ligand L-glutaminyl-L-threonine CAS: Registry No 74408-69-8 ChEBI: ID 183242 EPA DSSTox: ID DTXSID90707339 HMDB: ID HMDB0028807 Metabolomics Workbench: ID 78772 PubChem: CID 53877870 SureChEMBL: ID 4388337 UniChem: ID 26079867 Wikidata: ID Q76728100 |