BIOPEP-UWM: Report
| ID | 632 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 231.2483 | Monoisotopic mass | 231.1215 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gu J., Yue S., Yang X., Lu Z., Wang Z., Wei X., Zhou L., Zhao Z., Shi Z., Zhao Z. | |
| Title | |
| Unlocking novel angiotensin-converting enzyme inhibitory peptides from Nili Ravi buffalo milk β-casein: A synergistic strategy combining targeted hydrolysis, 3D-QSAR modeling, and mechanistic insights. Food Biosci., 71, 107346, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C9H17N3O4/c1-4(2)7(9(15)16)12-8(14)5(10)3-6(11)13/h4-5,7H,3,10H2,1-2H3,(H2,11,13)(H,12,14)(H,15,16)/t5-,7-/m0/s1 InChIKey=KWBQPGIYEZKDEG-FSPLSTOPSA-N Activity predicted using QSAR Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides ID 8851) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 8851 BRENDA: Ligand L-asparaginyl-L-valine ChEBI: ID 73825 ChemSpider: ID 5382949 MetaboLights: ID MTBLC73825 Metabolomics Workbench: ID 78715 PubChem: CID 7019993 SureChEMBL: ID SCHEMBL29426362 UniChem: ID 34729541 Wikidata: ID Q27144142 ZINC: ID ZINC000002560966 |