BIOPEP-UWM: Report
| ID | 633 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 232.2760 | Monoisotopic mass | 232.1418 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gu J., Yue S., Yang X., Lu Z., Wang Z., Wei X., Zhou L., Zhao Z., Shi Z., Zhao Z. | |
| Title | |
| Unlocking novel angiotensin-converting enzyme inhibitory peptides from Nili Ravi buffalo milk β-casein: A synergistic strategy combining targeted hydrolysis, 3D-QSAR modeling, and mechanistic insights. Food Biosci., 71, 107346, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C10H20N2O4/c1-5(2)4-7(11)9(14)12-8(6(3)13)10(15)16/h5-8,13H,4,11H2,1-3H3,(H,12,14)(H,15,16)/t6-,7+,8+/m1/s1 InChIKey=LRKCBIUDWAXNEG-CSMHCCOUSA-N Activity predicted using QSAR Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8824); the DFBP database Hypouricemic peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10741) Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10749) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 8824; 10741; 10749 BRENDA: Ligand L-leucyl-L-threonine ChEBI: ID 73589 ChemSpider: ID 8529330 DFBP: ID DFBPANOX0599 EROP-Moscow: ID E01610 FooDB: ID FDB111963 HMDB: ID HMDB0028939 J-GLOBAL: ID 202307009512758662 Metabolights: ID MTBLC73589 Metabolomics Workbench: ID 78872 Nikkaji: ID J3.790.788J NMRShiftDB: ID 60023641 PlantPepDB: ID PPepDB_3464 PubChem: CID 10353878 SCHOLIA: ID Q27141903 SureChEMBL: ID SCHEMBL8527776 UniChem: ID 26825780 Wikidata: ID Q27141903 |