BIOPEP-UWM: Report
| ID | 645 |
| Name | Alpha-amylase inhibitor |
| sequence |
| Function: | |||
| Predicted ligand of alpha-amylase (EC 3.2.1.1) (PDB: ID 1AMY) | |||
| Number of residues | 11 |
Activity code | aami |
| Activity : | alpha-amylase inhibitor |
|||
| Chemical mass | 1243.4111 | Monoisotopic mass | 1242.6813 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Aulyawati N., Anwar C., Raharjo T. J. | |
| Title | |
| α-Amylase inhibitor peptides derived from goat casein tryptic hydrolysate. Indones. J. Chem., 26, 130-142, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C55H90N18O15/c1-3-30(2)43(49(82)66-35(54(87)88)12-6-20-62-55(59)60)69-48(81)39-14-8-22-71(39)52(85)41-16-10-24-73(41)53(86)40-15-9-23-72(40)51(84)34(17-18-42(58)76)65-45(78)36(25-31-26-61-29-63-31)67-44(77)33(11-4-5-19-56)64-46(79)37(28-75)68-47(80)38-13-7-21-70(38)50(83)32(57)27-74/h26,29-30,32-41,43,74-75H,3-25,27-28,56-57H2,1-2H3,(H2,58,76)(H,61,63)(H,64,79)(H,65,78)(H,66,82)(H,67,77)(H,68,80)(H,69,81)(H,87,88)(H4,59,60,62)/t30-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,43-/m0/s1 InChIKey=BETIVGLIVXNMOM-GQUMMSORSA-N Activity predicted using molecular docking |
| Database reference: |