BIOPEP-UWM: Report
| ID | 675 |
| Name | Dipeptidyl peptidase IV (DPPIV) inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) (PDB: ID 2P88) | |||
| Number of residues | 5 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 543.5263 | Monoisotopic mass | 543.2281 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Manzanilla-Valdez M. L., Montaño S., Martinez-Villaluenga C., Zúñiga F., Boesch C., Hernandez-Alvarez A. J. | |
| Title | |
| Antioxidant, hypotensive, and antidiabetic breakthroughs: bromelain hydrolysis unlocks quinoa’s peptide potential - in silico and in vitro approach. J. Agric. Food Chem., 73, 22877−22894, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)NCC(=O)O InChI=1S/C21H33N7O10/c22-14(29)5-3-11(18(35)25-9-17(33)34)26-21(38)13(8-15(23)30)28-20(37)12(4-6-16(31)32)27-19(36)10-2-1-7-24-10/h10-13,24H,1-9H2,(H2,22,29)(H2,23,30)(H,25,35)(H,26,38)(H,27,36)(H,28,37)(H,31,32)(H,33,34)/t10-,11-,12-,13-/m0/s1 InChIKey=GNVXVAKDGVFOIN-CYDGBPFRSA-N Activity predicted using molecular docking |
| Database reference: |