BIOPEP-UWM: Report
| ID | 680 |
| Name | Lipoxygenase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Lipoxygenase (PDB: ID 1N8Q) | |||
| Number of residues | 5 |
Activity code | lox |
| Activity : | lipoxygenase inhibitor |
|||
| Chemical mass | 578.6132 | Monoisotopic mass | 578.2691 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Manzanilla-Valdez M. L., Montaño S., Martinez-Villaluenga C., Zúñiga F., Boesch C., Hernandez-Alvarez A. J. | |
| Title | |
| Antioxidant, hypotensive, and antidiabetic breakthroughs: bromelain hydrolysis unlocks quinoa’s peptide potential - in silico and in vitro approach. J. Agric. Food Chem., 73, 22877−22894, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)NCC(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C26H38N6O9/c1-3-14(2)22(28)25(39)31-16(9-10-21(35)36)24(38)32-17(11-15-7-5-4-6-8-15)23(37)29-13-20(34)30-18(26(40)41)12-19(27)33/h4-8,14,16-18,22H,3,9-13,28H2,1-2H3,(H2,27,33)(H,29,37)(H,30,34)(H,31,39)(H,32,38)(H,35,36)(H,40,41)/t14-,16-,17-,18-,22-/m0/s1 InChIKey=BFUKRLNZPARSQQ-UGCUYICYSA-N Activity predicted using molecular docking |
| Database reference: |