BIOPEP-UWM: Report
| ID | 691 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) (PDB ID: 1O86) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 481.5000 | Monoisotopic mass | 481.1955 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen J., Xie R., Mei Y., Chen W., Hu J., Liu H., Du H., Hao G., Ji X., Li S., Zhang J. | |
| Title | |
| Prospecting of novel angiotensin I-converting enzyme inhibitory peptides from bone collagen of Pelodiscus sinensis by computer-aided screening, molecular docking, and network pharmacology. Foods, 15, 663, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C24H27N5O6/c25-17(11-21(26)31)22(32)28-19(10-14-12-27-18-4-2-1-3-16(14)18)23(33)29-20(24(34)35)9-13-5-7-15(30)8-6-13/h1-8,12,17,19-20,27,30H,9-11,25H2,(H2,26,31)(H,28,32)(H,29,33)(H,34,35)/t17-,19-,20-/m0/s1 InChIKey=LGCVSPFCFXWUEY-IHPCNDPISA-N Bioactivity predicted by molecular docking |
| Database reference: |
| ChEBI: ID 160193 Metabolomics Workbench: ID 80214 PubChem: CID 145454293 UniChem: ID 176702867 Wikidata: ID Q106014209 |