BIOPEP-UWM: Report
| ID | 696 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) (PDB ID: 1O86) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 348.4186 | Monoisotopic mass | 348.1462 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen J., Xie R., Mei Y., Chen W., Hu J., Liu H., Du H., Hao G., Ji X., Li S., Zhang J. | |
| Title | |
| Prospecting of novel angiotensin I-converting enzyme inhibitory peptides from bone collagen of Pelodiscus sinensis by computer-aided screening, molecular docking, and network pharmacology. Foods, 15, 663, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CS)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C13H24N4O5S/c1-6(2)3-9(13(21)22)17-12(20)8(4-10(15)18)16-11(19)7(14)5-23/h6-9,23H,3-5,14H2,1-2H3,(H2,15,18)(H,16,19)(H,17,20)(H,21,22)/t7-,8-,9-/m0/s1 InChIKey=UPJGYXRAPJWIHD-CIUDSAMLSA-N Bioactivity predicted by molecular docking |
| Database reference: |
| ChEBI: ID 161166 Metabolomics Workbench: ID 80706 PubChem: CID 145454662 UniChem: ID 176703231 Wikidata: ID Q106015434 |