BIOPEP-UWM: Report
| ID | 70 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Predicted ligand of SARS-CoV-2 parent protease (EC 3.4.22.69) (MEROPS ID: C30.007) (PDB ID: 6LU7) | |||
| Number of residues | 3 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 304.2989 | Monoisotopic mass | 304.1378 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Behzadipour Y., Gholampour M., Pirhadi S., Seradj H., Khoshneviszadeh M., Hemmati S. | |
| Title | |
| Viral 3CLpro as a target for antiviral intervention using milk‑derived bioactive peptides. Int. J. Pept. Res. Therapeut., 27, 2703–2716, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C11H20N4O6/c1-5(11(20)21)14-10(19)7(4-16)15-9(18)6(12)2-3-8(13)17/h5-7,16H,2-4,12H2,1H3,(H2,13,17)(H,14,19)(H,15,18)(H,20,21)/t5-,6-,7-/m0/s1 InChIKey=KUBFPYIMAGXGBT-ACZMJKKPSA-N Bioactivity predicted using molecular docking |
| Database reference: |
| ChEBI: ID 162454 PubChem: CID 15431729 |