BIOPEP-UWM: Report
| ID | 73 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) (PDB ID: 1O86) | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 657.7112 | Monoisotopic mass | 657.3322 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yousafi Q., Batool J., Khan M. S., Perveen T., Sajid M. W., Hussain A., Mehmood A., Saleem S. | |
| Title | |
| In silico evaluation of food derived bioactive peptides as inhibitors of angiotensin converting enzyme (ACE). Int. J. Peptide Res. Therapeut., 27, 341–349, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C28H47N7O11/c1-5-14(4)21(30)26(43)31-15(8-9-19(29)37)23(40)32-16(11-20(38)39)24(41)34-22(13(2)3)27(44)35-10-6-7-18(35)25(42)33-17(12-36)28(45)46/h13-18,21-22,36H,5-12,30H2,1-4H3,(H2,29,37)(H,31,43)(H,32,40)(H,33,42)(H,34,41)(H,38,39)(H,45,46)/t14-,15-,16-,17-,18-,21-,22-/m0/s1 InChIKey=WRESWRCSQATZIZ-LCDGHNAASA-N Bioactivity predicted by molecular docking |
| Database reference: |