BIOPEP-UWM: Report
| ID | 8 |
| Name | Anticancer peptide |
| sequence |
| Function: | |||
| Predicted ligand of Keap1 protein (PDB ID: 2FLU) | |||
| Number of residues | 9 |
Activity code | ac |
| Activity : | anticancer |
|||
| Chemical mass | 1017.1726 | Monoisotopic mass | 1016.5524 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chai T.-T., Koh J.-A., Wong C. C.-C., Sabri M.Z., Wong F.-C. | |
| Title | |
| Computational screening for the anticancer potential of seed-derived antioxidant peptides: a cheminformatic approach. Molecules, 26, 7396, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C48H76N10O14/c1-24(2)18-31(51-43(66)33(21-28-12-14-29(61)15-13-28)52-45(68)36(23-59)56-40(63)30-10-8-16-50-30)41(64)53-34(22-38(49)62)44(67)57-39(27(7)60)47(70)58-17-9-11-37(58)46(69)54-32(19-25(3)4)42(65)55-35(48(71)72)20-26(5)6/h12-15,24-27,30-37,39,50,59-61H,8-11,16-23H2,1-7H3,(H2,49,62)(H,51,66)(H,52,68)(H,53,64)(H,54,69)(H,55,65)(H,56,63)(H,57,67)(H,71,72)/t27-,30+,31+,32+,33+,34+,35+,36+,37+,39+/m1/s1 InChIKey=PTUDEFPJGDGLOJ-WIIVDTJVSA-N Bioactivity predicted using molecular docking |
| Database reference: |