BIOPEP-UWM: Report
| ID | 80 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Predicted ligand of SARS-CoV-2 parent protease (EC 3.4.22.69) (MEROPS ID: C30.007) (PDB ID: 6LU7), spike glycoprotein RBD (PDB ID: 6LZG) and papain-like protein (EC 3.4.19.12) (MEROPS ID: C16.009) (PDB ID: 6WX4) | |||
| Number of residues | 7 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 770.9819 | Monoisotopic mass | 770.4459 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wong F.-C., Ong J.-H., Kumar D. T., Chai T.-T. | |
| Title | |
| In silico identification of multi‑target anti‑SARS‑CoV‑2 peptides from quinoa seed proteins. Int. J. Peptide Res. Therapeut., 27, 1837–1847, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCSC)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C34H62N10O8S/c1-8-19(4)26(43-27(45)20(5)35)31(49)40-22(11-9-14-38-34(36)37)29(47)39-21(6)28(46)41-23(13-16-53-7)32(50)44-15-10-12-25(44)30(48)42-24(33(51)52)17-18(2)3/h18-26H,8-17,35H2,1-7H3,(H,39,47)(H,40,49)(H,41,46)(H,42,48)(H,43,45)(H,51,52)(H4,36,37,38)/t19-,20-,21-,22-,23-,24-,25-,26-/m0/s1 InChIKey=BNCZHORSMUPRHM-CAQMSIDYSA-N Bioactivity predicted using molecular docking |
| Database reference: |