BIOPEP-UWM: Report
| ID | 87 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| Predicted ligand of hTAS2R1 bitter taste receptor | |||
| Number of residues | 4 |
Activity code | bi |
| Activity : | bitter taste peptide |
|||
| Chemical mass | 519.5891 | Monoisotopic mass | 519.2684 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang F., Yang W., Zhou B. | |
| Title | |
| Molecular-level understanding of the hTAS2R1 receptor-bitter tasting tetra-peptide binding: a structural biology study based on computational approaches. New J. Chem., 45, 21369-21381, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C25H37N5O7/c26-13-5-4-9-17(27)24(35)30-14-6-10-20(30)23(34)29-19(15-16-7-2-1-3-8-16)22(33)28-18(25(36)37)11-12-21(31)32/h1-3,7-8,17-20H,4-6,9-15,26-27H2,(H,28,33)(H,29,34)(H,31,32)(H,36,37)/t17-,18-,19-,20-/m0/s1 InChIKey=LTPIJJDCUGOUSN-MUGJNUQGSA-N Activity predicted using 3D QSAR |
| Database reference: |