BIOPEP-UWM: Report
| ID | 88 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) (PDB ID: 1O86) | |||
| Number of residues | 8 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 901.0804 | Monoisotopic mass | 900.4723 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lin K., Zhang L., Han X., Cheng D. | |
| Title | |
| Novel angiotensin I-converting enzyme inhibitory peptides from protease hydrolysates of Qula casein: Quantitative structure-activity relationship modeling and molecular docking study. J. Funct. Foods, 32, 266-277, 2017 | |
| Year | Source |
| 2017 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)NCC(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C39H68N10O12S/c1-6-22(4)32(37(58)43-20-29(51)47-31(21(2)3)39(60)61)48-35(56)25(16-19-62-5)45-36(57)27-11-9-18-49(27)38(59)26(13-15-30(52)53)46-34(55)24(10-7-8-17-40)44-33(54)23(41)12-14-28(42)50/h21-27,31-32H,6-20,40-41H2,1-5H3,(H2,42,50)(H,43,58)(H,44,54)(H,45,57)(H,46,55)(H,47,51)(H,48,56)(H,52,53)(H,60,61)/t22-,23-,24-,25-,26-,27-,31-,32-/m0/s1 InChIKey=VPONJLWZWPMSFB-FIOLWHMYSA-N Bioactivity predicted by molecular docking |
| Database reference: |