BIOPEP-UWM: Report
| ID | 9 |
| Name | DPPIV inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Dipeptidyl peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) (PDB ID: 1PFQ) | |||
| Number of residues | 7 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 544.5606 | Monoisotopic mass | 544.2710 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Garzón A. G., Veras F. F., Brandelli A., Drago S. R. | |
| Title | |
| Purification, identification and in silico studies of antioxidant, antidiabetogenic and antibacterial peptides obtained from sorghum spent grain hydrolysate. LWT, 153, 112414, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: NCC(=O)NCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)NCC(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C20H36N10O8/c1-10(29-18(36)11(2)28-15(33)8-25-13(31)6-21)17(35)27-7-14(32)26-9-16(34)30-12(19(37)38)4-3-5-24-20(22)23/h10-12H,3-9,21H2,1-2H3,(H,25,31)(H,26,32)(H,27,35)(H,28,33)(H,29,36)(H,30,34)(H,37,38)(H4,22,23,24)/t10-,11-,12-/m0/s1 InChIKey=LAXLRBTXURSLIK-SRVKXCTJSA-N Bioactivity predicted using molecular docking |
| Database reference: |